Introduction：Basic information about CAS 4828-27-7|clocortolone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | clocortolone |
|---|
| CAS Number | 4828-27-7 | Molecular Weight | 410.907 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 566.0±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C22H28ClFO4 | Melting Point | 254ºC |
|---|
| MSDS | / | Flash Point | 296.1±30.1 °C |
|---|
Names
| Name | clocortolone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 566.0±50.0 °C at 760 mmHg |
|---|
| Melting Point | 254ºC |
|---|
| Molecular Formula | C22H28ClFO4 |
|---|
| Molecular Weight | 410.907 |
|---|
| Flash Point | 296.1±30.1 °C |
|---|
| Exact Mass | 410.166016 |
|---|
| PSA | 74.60000 |
|---|
| LogP | 2.02 |
|---|
| Vapour Pressure | 0.0±3.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.580 |
|---|
| InChIKey | YMTMADLUXIRMGX-RFPWEZLHSA-N |
|---|
| SMILES | CC1CC2C3CC(F)C4=CC(=O)C=CC4(C)C3(Cl)C(O)CC2(C)C1C(=O)CO |
|---|
Synonyms
| clocortolone |
| (6α,11β,16α)-9-Chloro-6-fluoro-11,21-dihydroxy-16-methylpregna-1,4-diene-3,20-dione |
| 9-Chlor |
| Pregna-1,4-diene-3,20-dione, 9-chloro-6-fluoro-11,21-dihydroxy-16-methyl-, (6α,11β,16α)- |
| (6a,11b,16a)-9-Chloro-6-fluoro-11,21-dihydroxy-16-methylpregna-1,4-diene-3,20-dione |
| 9-Chloro-6a-fluoro-16a-methyl-1,4-pregnadiene-11b,21-diol-3,20-dione |
