Introduction：Basic information about CAS 74912-19-9|Naboctate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Naboctate |
|---|
| CAS Number | 74912-19-9 | Molecular Weight | 511.77900 |
|---|
| Density | 1.02g/cm3 | Boiling Point | 595.9ºC at 760 mmHg |
|---|
| Molecular Formula | C33H53NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 314.2ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.02g/cm3 |
|---|
| Boiling Point | 595.9ºC at 760 mmHg |
|---|
| Molecular Formula | C33H53NO3 |
|---|
| Molecular Weight | 511.77900 |
|---|
| Flash Point | 314.2ºC |
|---|
| Exact Mass | 511.40300 |
|---|
| PSA | 38.77000 |
|---|
| LogP | 8.92260 |
|---|
| Index of Refraction | 1.53 |
|---|
| InChIKey | UDQAWRWPAGUCRX-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCCCC(C)c1cc(OC(=O)CCCN(CC)CC)c2c(c1)OC(C)(C)C1=C2CC(C)CC1 |
|---|
