Introduction：Basic information about CAS 17969-45-8|2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]propanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]propanoic acid |
|---|
| CAS Number | 17969-45-8 | Molecular Weight | 312.18200 |
|---|
| Density | 1.518g/cm3 | Boiling Point | 472.7ºC at 760mmHg |
|---|
| Molecular Formula | C12H10BrNO2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 239.7ºC |
|---|
Names
| Name | 2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.518g/cm3 |
|---|
| Boiling Point | 472.7ºC at 760mmHg |
|---|
| Molecular Formula | C12H10BrNO2S |
|---|
| Molecular Weight | 312.18200 |
|---|
| Flash Point | 239.7ºC |
|---|
| Exact Mass | 310.96200 |
|---|
| PSA | 78.43000 |
|---|
| LogP | 3.76070 |
|---|
| Index of Refraction | 1.619 |
|---|
| InChIKey | JGQKYWPSFPCKLW-UHFFFAOYSA-N |
|---|
| SMILES | CC(C(=O)O)c1nc(-c2ccc(Br)cc2)cs1 |
|---|
Safety Information
Customs
| HS Code | 2934100090 |
|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| Brofezil |
| Brofezilo |
| Brofezilum |
| UNII-E375EMI4HW |
| (RS)-2-(4-(4-Bromophenyl)-2-thiazolul)propionsaeure |
| 2-[4-(4-bromo-phenyl)-thiazol-2-yl]-propionic acid |
