Introduction：Basic information about CAS 105806-65-3|Efegatran, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Efegatran |
|---|
| CAS Number | 105806-65-3 | Molecular Weight | 416.51700 |
|---|
| Density | 1.29g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C21H32N6O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
Chemical & Physical Properties
| Density | 1.29g/cm3 |
|---|
| Molecular Formula | C21H32N6O3 |
|---|
| Molecular Weight | 416.51700 |
|---|
| Exact Mass | 416.25400 |
|---|
| PSA | 140.41000 |
|---|
| LogP | 1.66570 |
|---|
| Index of Refraction | 1.62 |
|---|
| InChIKey | KAGLWQUWUNBAOO-KSZLIROESA-N |
|---|
| SMILES | CNC(Cc1ccccc1)C(=O)N1CCCC1C(=O)NC(C=O)CCCN=C(N)N |
|---|
