Introduction：Basic information about CAS 88303-60-0|Losoxantrone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Losoxantrone |
|---|
| CAS Number | 88303-60-0 | Molecular Weight | 425.48100 |
|---|
| Density | 1.46g/cm3 | Boiling Point | 765.2ºC at 760 mmHg |
|---|
| Molecular Formula | C22H27N5O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 416.6ºC |
|---|
Names
| Name | Losoxantrone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.46g/cm3 |
|---|
| Boiling Point | 765.2ºC at 760 mmHg |
|---|
| Molecular Formula | C22H27N5O4 |
|---|
| Molecular Weight | 425.48100 |
|---|
| Flash Point | 416.6ºC |
|---|
| Exact Mass | 425.20600 |
|---|
| PSA | 131.67000 |
|---|
| LogP | 1.27680 |
|---|
| Index of Refraction | 1.706 |
|---|
| InChIKey | YROQEQPFUCPDCP-UHFFFAOYSA-N |
|---|
| SMILES | O=C1c2c(O)cccc2-c2nn(CCNCCO)c3ccc(NCCNCCO)c1c23 |
|---|
Synonyms
| CI-941 |
| Anthra(1,9-cd)pyrazol-6(2H)-one,7-hydroxy-2-(2-((2-hydroxyethyl)amino)ethyl)-5-((2-((2-hydroxyethyl)amino)ethyl)amino) |
| bianthrazole |
| Losoxantrone [INN:BAN] |
| 7-hydroxy-2-[2-[(2-hydroxyethyl)amino]ethyl]-5-[[2-[(2-hydroxyethyl)amino]ethyl]amino]anthra[1,9-cd]pyrazol-6(2H)-one |
| DuP-941 |
| Bis-alkylamino anthrapyrazole |
