Introduction：Basic information about CAS 54063-47-7|Gemazocine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Gemazocine |
|---|
| CAS Number | 54063-47-7 | Molecular Weight | 299.45000 |
|---|
| Density | 1.078g/cm3 | Boiling Point | 415.4ºC at 760mmHg |
|---|
| Molecular Formula | C20H29NO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 187.4ºC |
|---|
Names
| Name | Gemazocine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.078g/cm3 |
|---|
| Boiling Point | 415.4ºC at 760mmHg |
|---|
| Molecular Formula | C20H29NO |
|---|
| Molecular Weight | 299.45000 |
|---|
| Flash Point | 187.4ºC |
|---|
| Exact Mass | 299.22500 |
|---|
| PSA | 23.47000 |
|---|
| LogP | 4.04450 |
|---|
| Index of Refraction | 1.568 |
|---|
| InChIKey | AFZOCGNTFCGOEE-UHFFFAOYSA-N |
|---|
| SMILES | CCC12CCN(CC3CC3)C(Cc3ccc(O)cc31)C2(C)C |
|---|
Synonyms
| Gemozocinum |
| UNII-V1A2S0LB62 |
| 2-Cyclopropylmethyl-9,9-dimethyl-5-ethyl-2'-hydroxy-6,7-benzomorphan |
