Introduction：Basic information about CAS 16170-76-6|bromebric acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | bromebric acid |
|---|
| CAS Number | 16170-76-6 | Molecular Weight | 285.09100 |
|---|
| Density | / | Boiling Point | 417.9ºC at 760mmHg |
|---|
| Molecular Formula | C11H9BrO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 206.5ºC |
|---|
Names
| Name | bromebric acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 417.9ºC at 760mmHg |
|---|
| Molecular Formula | C11H9BrO4 |
|---|
| Molecular Weight | 285.09100 |
|---|
| Flash Point | 206.5ºC |
|---|
| Exact Mass | 283.96800 |
|---|
| PSA | 63.60000 |
|---|
| LogP | 2.24130 |
|---|
| Vapour Pressure | 9.92E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.601 |
|---|
| InChIKey | UPZFHUODAYGHDZ-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(C(=O)C(Br)=CC(=O)O)cc1 |
|---|
Safety Information
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 3-p-Anisoyl-3-bromacrylsaeure |
| 2-Butenoic acid,3-bromo-4-(4-methoxyphenyl)-4-oxo |
| (E)-3-bromo-3-(4'-methoxybenzoyl)acrylic acid |
| 3-p-Anisoyl-3-bromoacrylic acid |
| 3-bromo-4-(4-methoxy-phenyl)-4-oxo-cis-crotonic acid |
| Acrylic acid,3-p-anisoyl-3-bromo |
| 3-Brom-4-(4-methoxy-phenyl)-4-oxo-cis-crotonsaeure |
