Introduction：Basic information about CAS 52829-30-8|7-chloro-1-(2,3-dihydroxypropyl)-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 7-chloro-1-(2,3-dihydroxypropyl)-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-one |
|---|
| CAS Number | 52829-30-8 | Molecular Weight | 362.78300 |
|---|
| Density | 1.41g/cm3 | Boiling Point | 629.8ºC at 760mmHg |
|---|
| Molecular Formula | C18H16ClFN2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 334.7ºC |
|---|
Names
| Name | 7-chloro-1-(2,3-dihydroxypropyl)-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.41g/cm3 |
|---|
| Boiling Point | 629.8ºC at 760mmHg |
|---|
| Molecular Formula | C18H16ClFN2O3 |
|---|
| Molecular Weight | 362.78300 |
|---|
| Flash Point | 334.7ºC |
|---|
| Exact Mass | 362.08300 |
|---|
| PSA | 73.13000 |
|---|
| LogP | 1.51690 |
|---|
| Index of Refraction | 1.635 |
|---|
| InChIKey | RCDQRWWSKKYAJG-UHFFFAOYSA-N |
|---|
| SMILES | O=C1CN=C(c2ccccc2F)c2cc(Cl)ccc2N1CC(O)CO |
|---|
Synonyms
| Proflazepam |
| UNII-545MN0F125 |
| 7-Chloro-1-(2,3-dihydroxypropyl)-5-(o-fluorophenyl)-1,3-dihydro-2H-1,4-benzodiazepin-2-one |
| Proflazepam [INN] |
