Introduction:Basic information about CAS 40966-79-8|methoxymethyl (2S,5R,6R)-6-(2,2-dimethyl-5-oxo-4-phenylimidazolidin-1-yl)-3,3-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | methoxymethyl (2S,5R,6R)-6-(2,2-dimethyl-5-oxo-4-phenylimidazolidin-1-yl)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|
| CAS Number | 40966-79-8 | Molecular Weight | 433.52100 |
|---|
| Density | 1.35g/cm3 | Boiling Point | 619.8ºC at 760mmHg |
|---|
| Molecular Formula | C21H27N3O5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 328.6ºC |
|---|
Names
| Name | methoxymethyl (2S,5R,6R)-6-(2,2-dimethyl-5-oxo-4-phenylimidazolidin-1-yl)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.35g/cm3 |
|---|
| Boiling Point | 619.8ºC at 760mmHg |
|---|
| Molecular Formula | C21H27N3O5S |
|---|
| Molecular Weight | 433.52100 |
|---|
| Flash Point | 328.6ºC |
|---|
| Exact Mass | 433.16700 |
|---|
| PSA | 113.48000 |
|---|
| LogP | 1.67820 |
|---|
| Index of Refraction | 1.627 |
|---|
| InChIKey | QTQPGZVDUCMVLK-KRWWSPQJSA-N |
|---|
| SMILES | COCOC(=O)C1N2C(=O)C(N3C(=O)C(c4ccccc4)NC3(C)C)C2SC1(C)C |
|---|
Synonyms
| BL-P1761 |
| Sarpicillin |
| Sarpicilline [INN-French] |
| Sarpicillinum |
| Sarpicillina |
| Sarpicilline |
| Hetacillin-methoxymethylester |
| Sarpicillin (USAN) |