Introduction：Basic information about CAS 120656-74-8|Trefentanil, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Trefentanil |
|---|
| CAS Number | 120656-74-8 | Molecular Weight | 466.55100 |
|---|
| Density | 1.24g/cm3 | Boiling Point | 578ºC at 760mmHg |
|---|
| Molecular Formula | C25H31FN6O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 303.4ºC |
|---|
Names
| Name | N-[1-[2-(4-ethyl-5-oxotetrazol-1-yl)ethyl]-4-phenylpiperidin-4-yl]-N-(2-fluorophenyl)propanamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.24g/cm3 |
|---|
| Boiling Point | 578ºC at 760mmHg |
|---|
| Molecular Formula | C25H31FN6O2 |
|---|
| Molecular Weight | 466.55100 |
|---|
| Flash Point | 303.4ºC |
|---|
| Exact Mass | 466.24900 |
|---|
| PSA | 76.26000 |
|---|
| LogP | 2.97120 |
|---|
| Vapour Pressure | 2.34E-13mmHg at 25°C |
|---|
| Index of Refraction | 1.618 |
|---|
| InChIKey | RJSCINHYBGMIFT-UHFFFAOYSA-N |
|---|
| SMILES | CCC(=O)N(c1ccccc1F)C1(c2ccccc2)CCN(CCn2nnn(CC)c2=O)CC1 |
|---|
Synonyms
| n-{1-[2-(4-ethyl-5-oxo-4,5-dihydro-1h-tetrazol-1-yl)ethyl]-4-phenylpiperidin-4-yl}-n-(2-fluorophenyl)propanamide |
| 1-[2-(4-ethyl-4,5-dihydro-5-oxo-1H-tetrazol-1-yl)ethyl]-4-phenyl-4-[N-(2-fluorophenyl)propionamido]piperidine |
| Trefentanil [INN] |
| Trefentanil |
