Introduction：Basic information about CAS 84203-09-8|Trifenagrel, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Trifenagrel |
|---|
| CAS Number | 84203-09-8 | Molecular Weight | 383.48600 |
|---|
| Density | 1.135g/cm3 | Boiling Point | 584.7ºC at 760 mmHg |
|---|
| Molecular Formula | C25H25N3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 307.4ºC |
|---|
Names
| Name | 2-[2-(4,5-diphenyl-1H-imidazol-2-yl)phenoxy]-N,N-dimethylethanamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.135g/cm3 |
|---|
| Boiling Point | 584.7ºC at 760 mmHg |
|---|
| Molecular Formula | C25H25N3O |
|---|
| Molecular Weight | 383.48600 |
|---|
| Flash Point | 307.4ºC |
|---|
| Exact Mass | 383.20000 |
|---|
| PSA | 41.15000 |
|---|
| LogP | 5.35110 |
|---|
| Index of Refraction | 1.608 |
|---|
| InChIKey | KGVYOGLFOPNPDJ-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)CCOc1ccccc1-c1nc(-c2ccccc2)c(-c2ccccc2)[nH]1 |
|---|
Synonyms
| Trifenagrel |
| Trifenagrelum |
| Trifenagrelum [Latin] |
| UNII-59X5ME2O06 |
| Trifenagrel (USAN/INN) |
