Introduction:Basic information about CAS 41441-42-3|1,3-dioxo-2-prop-2-enylisoindole-5-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylic acid |
|---|
| CAS Number | 41441-42-3 | Molecular Weight | 231.20400 |
|---|
| Density | 1.407g/cm3 | Boiling Point | 437ºC at 760mmHg |
|---|
| Molecular Formula | C12H9NO4 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 218.1ºC |
|---|
Names
| Name | 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.407g/cm3 |
|---|
| Boiling Point | 437ºC at 760mmHg |
|---|
| Molecular Formula | C12H9NO4 |
|---|
| Molecular Weight | 231.20400 |
|---|
| Flash Point | 218.1ºC |
|---|
| Exact Mass | 231.05300 |
|---|
| PSA | 74.68000 |
|---|
| LogP | 1.10470 |
|---|
| InChIKey | WVOXIWJWBBJKCZ-UHFFFAOYSA-N |
|---|
| SMILES | C=CCN1C(=O)c2ccc(C(=O)O)cc2C1=O |
|---|
Safety Information
Customs
| HS Code | 2925190090 |
|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| N-Allyl-4-phthalimidcarbonsaeure |
| HMS1732E22 |
| 2-allyl-1,3-dioxoisoindoline-5-carboxylic acid |
| F3268-0024 |
| 2-allyl-1,3-dioxo-1,3-dihydro-isoindole-5-carboxylic acid |