Introduction:Basic information about CAS 224185-19-7|1-Bromo-2-fluoro-4-methyl-5-nitrobenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Bromo-2-fluoro-4-methyl-5-nitrobenzene |
|---|
| CAS Number | 224185-19-7 | Molecular Weight | 234.023 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 266.6±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H5BrFNO2 | Melting Point | 59-63°C |
|---|
| MSDS | ChineseUSA | Flash Point | 115.1±25.9 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 1-bromo-2-fluoro-4-methyl-5-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 266.6±35.0 °C at 760 mmHg |
|---|
| Melting Point | 59-63°C |
|---|
| Molecular Formula | C7H5BrFNO2 |
|---|
| Molecular Weight | 234.023 |
|---|
| Flash Point | 115.1±25.9 °C |
|---|
| Exact Mass | 232.948761 |
|---|
| PSA | 45.82000 |
|---|
| LogP | 2.75 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.571 |
|---|
| InChIKey | MTTNTJRJOFVWSY-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(F)c(Br)cc1[N+](=O)[O-] |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H319 |
|---|
| Precautionary Statements | P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xn:Harmful; |
|---|
| Risk Phrases | R22;R36 |
|---|
| Safety Phrases | S26-S36/37 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2904909090 |
|---|
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| Benzene, 1-bromo-2-fluoro-4-methyl-5-nitro- |
| 3-bromo-4-fluoro-6-methylnitrobenzene |
| 1-Bromo-2-fluoro-4-methyl-5-nitrobenzene |
| 1-Bromo-2-fluoro-4-methyl-5-nitro-benzene |
| MFCD04039299 |
| 2-Nitro-4-Bromo-5-Fluorotoluene |
| 4-BROMO-3-FLUORO-6-NITROTOLUENE |
| 4-Bromo-5-Fluoro-2-Nitrotoluene |