Introduction:Basic information about CAS 174501-64-5|1-Butyl-3-Methylimidazolium Hexafluorophosphate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Butyl-3-Methylimidazolium Hexafluorophosphate |
|---|
| CAS Number | 174501-64-5 | Molecular Weight | 284.18200 |
|---|
| Density | 1.38 g/mL at 20 °C(lit.) | Boiling Point | >340°C |
|---|
| Molecular Formula | C8H15F6N2P | Melting Point | 6.5 °C |
|---|
| MSDS | / | Flash Point | >350°C |
|---|
Names
| Name | 1-Butyl-3-methylimidazolium hexafluorophosphate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.38 g/mL at 20 °C(lit.) |
|---|
| Boiling Point | >340°C |
|---|
| Melting Point | 6.5 °C |
|---|
| Molecular Formula | C8H15F6N2P |
|---|
| Molecular Weight | 284.18200 |
|---|
| Flash Point | >350°C |
|---|
| Exact Mass | 284.08800 |
|---|
| PSA | 22.40000 |
|---|
| LogP | 4.49510 |
|---|
| Index of Refraction | n20/D 1.41 |
|---|
| InChIKey | IXQYBUDWDLYNMA-UHFFFAOYSA-N |
|---|
| SMILES | CCCCn1cc[n+](C)c1.F[P-](F)(F)(F)(F)F |
|---|
Safety Information
| Hazard Codes | Xn:Harmful; |
|---|
| Risk Phrases | R22;R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| 1-butyl-3-methylimidazol-3-ium,hexafluorophosphate |
| 1-Butyl-3-methylimidazolium hexafluorophosphate |
| [BMIM][PF6] |
| 1-(But-1-yl)-3-methyl-1H-imidazol-3-ium hexafluorophosphate |
| MFCD03093295 |
| 3-Butyl-1-methyl-1H-imidazol-3-ium hexafluorophosphate |
| BMIMPF6 |
| 1-Butyl-3-methyl-1H-imidazol-3-ium hexafluorophosphate(V) |
| 1-butyl-3-methyl-imidazol-3-ium hexafluorophosphate |
| 1-butyl-3-methylimidazol-3-ium hexafluorophosphate |
| 1-butyl-3-methyl-imidazolium hexafluorophosphate |