Introduction：Basic information about CAS 175230-50-9|Isopropyl 4,4,4-Trifluoroacetoacetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Isopropyl 4,4,4-Trifluoroacetoacetate |
|---|
| CAS Number | 175230-50-9 | Molecular Weight | 198.14000 |
|---|
| Density | 1.20 | Boiling Point | 42°C 28mm |
|---|
| Molecular Formula | C7H9F3O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 42°C/28mm |
|---|
Names
| Name | Isopropyl 4,4,4-Trifluoroacetoacetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.20 |
|---|
| Boiling Point | 42°C 28mm |
|---|
| Molecular Formula | C7H9F3O3 |
|---|
| Molecular Weight | 198.14000 |
|---|
| Flash Point | 42°C/28mm |
|---|
| Exact Mass | 198.05000 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 1.45950 |
|---|
| Vapour Pressure | 2.42mmHg at 25°C |
|---|
| Index of Refraction | 1.3891 |
|---|
| InChIKey | XLBGYZLICFMDDS-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)OC(=O)CC(=O)C(F)(F)F |
|---|
Safety Information
| Hazard Codes | Xi,F,Xn |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S16-S36-S26 |
|---|
| RIDADR | 3272 |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 4,4,4-Trifluoroacetoacetic Acid Isopropyl Ester |
| MFCD00040990 |
| propan-2-yl 4,4,4-trifluoro-3-oxobutanoate |
