Introduction:Basic information about CAS 35059-50-8|TERT-BUTYL 2-DIAZOACETATE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | TERT-BUTYL 2-DIAZOACETATE |
|---|
| CAS Number | 35059-50-8 | Molecular Weight | 142.15600 |
|---|
| Density | 1.026 g/mL at 25ºC(lit.) | Boiling Point | 51-53ºC12 mm Hg(lit.) |
|---|
| Molecular Formula | C6H10N2O2 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 110 °F |
|---|
| Symbol | GHS02, GHS07, GHS08 | Signal Word | Danger |
|---|
Names
| Name | 2-diazonio-1-[(2-methylpropan-2-yl)oxy]ethenolate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.026 g/mL at 25ºC(lit.) |
|---|
| Boiling Point | 51-53ºC12 mm Hg(lit.) |
|---|
| Molecular Formula | C6H10N2O2 |
|---|
| Molecular Weight | 142.15600 |
|---|
| Flash Point | 110 °F |
|---|
| Exact Mass | 142.07400 |
|---|
| PSA | 63.69000 |
|---|
| LogP | 0.70976 |
|---|
| Index of Refraction | n20/D 1.453(lit.) |
|---|
| InChIKey | JBVSBLLOZVDAAZ-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)C=[N+]=[N-] |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Symbol | GHS02, GHS07, GHS08 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H226-H302-H315-H319-H335-H350-H361 |
|---|
| Precautionary Statements | P201-P261-P281-P305 + P351 + P338-P308 + P313 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|
| Hazard Codes | T: Toxic; |
|---|
| Risk Phrases | 45-10-22-36/37/38-63 |
|---|
| Safety Phrases | 53-16-23-36/37/39-45 |
|---|
| RIDADR | UN 1993 3/PG 3 |
|---|
| Hazard Class | 3.0 |
|---|
| HS Code | 2927000090 |
|---|
Customs
| HS Code | 2927000090 |
|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| tBu-diazoacetate |
| tert-Butyl diazoacetate |
| Acetic acid,diazo-,tert-butylester (6CI,7CI,8CI) |
| Aceticacid,diazo-,1,1-dimethylethyl ester (9CI) |
| Acetic acid,2-diazo-,1,1-dimethylethyl ester |
| MFCD01318409 |
| Diazoacetic acid1,1-dimethylethyl ester |
| 2-Diazoacetic acid tert-butyl ester |
| t-BuO2CCHN2 |
| N2CHCO2-(tBu) |
| (tert-Butoxycarbonyl)diazomethane |
| 1,1-Dimethylethyldiazoacetate |