Introduction：Basic information about CAS 69275-10-1|Anorexigenic Peptide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Anorexigenic Peptide |
|---|
| CAS Number | 69275-10-1 | Molecular Weight | 323.30500 |
|---|
| Density | 1.65 g/cm3 | Boiling Point | 1010.7ºC at 760 mmHg |
|---|
| Molecular Formula | C13H17N5O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 565.1ºC |
|---|
Names
| Name | 2-[[(2S)-3-(4H-imidazol-4-yl)-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]propanoyl]amino]acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.65 g/cm3 |
|---|
| Boiling Point | 1010.7ºC at 760 mmHg |
|---|
| Molecular Formula | C13H17N5O5 |
|---|
| Molecular Weight | 323.30500 |
|---|
| Flash Point | 565.1ºC |
|---|
| Exact Mass | 323.12300 |
|---|
| PSA | 153.28000 |
|---|
| Index of Refraction | 1.599 |
|---|
| InChIKey | GVCTYSKUHKXJDZ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CNC(=O)C(Cc1cnc[nH]1)NC(=O)C1CCC(=O)N1 |
|---|
Synonyms
| pyroglutamyl-histidyl-glycine |
| Pglu-his-gly |
| Glycine,N-(N-(5-oxo-L-prolyl)-L-histidyl) |
| Colon mitosis inhibitor |
| Anorexigenic peptide |
| Pglu-his-gly-OH |
| Pyro-glu-his-gly-OH |
| Pyr-his-gly |
