Introduction:Basic information about CAS 723-42-2|Ditolamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ditolamide |
|---|
| CAS Number | 723-42-2 | Molecular Weight | 255.37600 |
|---|
| Density | 1.076g/cm3 | Boiling Point | 358.6ºC at 760 mmHg |
|---|
| Molecular Formula | C13H21NO2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 170.7ºC |
|---|
Names
| Name | N,N-Dipropyl-p-toluenesulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.076g/cm3 |
|---|
| Boiling Point | 358.6ºC at 760 mmHg |
|---|
| Molecular Formula | C13H21NO2S |
|---|
| Molecular Weight | 255.37600 |
|---|
| Flash Point | 170.7ºC |
|---|
| Exact Mass | 255.12900 |
|---|
| PSA | 45.76000 |
|---|
| LogP | 3.88650 |
|---|
| Index of Refraction | 1.517 |
|---|
| InChIKey | AUUADVNHIYKUBA-UHFFFAOYSA-N |
|---|
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(C)cc1 |
|---|
Safety Information
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| Toluol-4-sulfonsaeure-dipropylamid |
| 4-Methyl-N,N-dipropylbenzenesulfonamide |
| N,N-dipropyl-toluene-4-sulfonamide |
| N,N-Dipropyl-p-toluolsulfonamid |
| Ditolamide |
| 4-Methyl-N,N-di-n-propylbenzenesulfonaMide |
| Di-n-propylamintosylat |
| N,N-dipropyltosylamide |
| N,N-Dipropyl-toluol-4-sulfonamid |