Introduction：Basic information about CAS 2403-27-2|2-Propen-1-one,1-(4-bromophenyl)-3-phenyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Propen-1-one,1-(4-bromophenyl)-3-phenyl- |
|---|
| CAS Number | 2403-27-2 | Molecular Weight | 287.15100 |
|---|
| Density | 1.393g/cm3 | Boiling Point | 402.2ºC at 760mmHg |
|---|
| Molecular Formula | C15H11BrO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 82.4ºC |
|---|
Names
| Name | 4'-Bromochalcone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.393g/cm3 |
|---|
| Boiling Point | 402.2ºC at 760mmHg |
|---|
| Molecular Formula | C15H11BrO |
|---|
| Molecular Weight | 287.15100 |
|---|
| Flash Point | 82.4ºC |
|---|
| Exact Mass | 285.99900 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 4.34520 |
|---|
| InChIKey | QMHDTKUBDZUMNH-IZZDOVSWSA-N |
|---|
| SMILES | O=C(C=Cc1ccccc1)c1ccc(Br)cc1 |
|---|
Safety Information
Customs
| HS Code | 2914700090 |
|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 1-(4-bromo-phenyl)-3-phenyl-propenone |
| 4'-Brom-chalkon |
| 4-Bromophenylstyryl ketone |
| (2E)-1-(4-bromophenyl)-3-phenylprop-2-en-1-one |
| 2-Propen-1-one,1-(4-bromophenyl)-3-phenyl |
| 1-(4-Bromophenyl)-3-phenyl-2-propen-1-one |
| 1-(4-bromophenyl)-3-phenylprop-2-en-1-one |
| Styryl(4-bromophenyl) ketone |
| 4'-bromo-chalcone |
