Introduction：Basic information about CAS 7299-89-0|bis(2-ethylbutyl) phthalate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | bis(2-ethylbutyl) phthalate |
|---|
| CAS Number | 7299-89-0 | Molecular Weight | 334.45000 |
|---|
| Density | 1.01 g/cm3 | Boiling Point | 341.5ºC at 760 mmHg |
|---|
| Molecular Formula | C20H30O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 180ºC |
|---|
Names
| Name | bis(2-ethylbutyl) benzene-1,2-dicarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.01 g/cm3 |
|---|
| Boiling Point | 341.5ºC at 760 mmHg |
|---|
| Molecular Formula | C20H30O4 |
|---|
| Molecular Weight | 334.45000 |
|---|
| Flash Point | 180ºC |
|---|
| Exact Mass | 334.21400 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 4.87260 |
|---|
| Index of Refraction | 1.492 |
|---|
| InChIKey | RXUXJHZMTDAMFZ-UHFFFAOYSA-N |
|---|
| SMILES | CCC(CC)COC(=O)c1ccccc1C(=O)OCC(CC)CC |
|---|
Synonyms
| Bis-(2-ethylbutyl)-phthalat |
| Bis-(2-aethyl-butyl)-phthalat |
| 1,2-benzenedicarboxylic acid,bis(2-ethylbutyl) ester |
| Phthalsaeure-bis-(2-aethyl-butylester) |
| Bis(2-ethylbutyl) phthalate |
| Bis(2-ethyl-n-butyl) phthalate |
| phthalic acid bis-(2-ethyl-butyl ester) |
