Introduction：Basic information about CAS 2901-19-1|Benzeneacetic acid,4-methoxy-a,a-dimethyl-, ethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzeneacetic acid,4-methoxy-a,a-dimethyl-, ethyl ester |
|---|
| CAS Number | 2901-19-1 | Molecular Weight | 222.28000 |
|---|
| Density | 1.026g/cm3 | Boiling Point | 295.6ºC at 760 mmHg |
|---|
| Molecular Formula | C13H18O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 119.8ºC |
|---|
Names
| Name | ethyl 2-(4-methoxyphenyl)-2-methylpropanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.026g/cm3 |
|---|
| Boiling Point | 295.6ºC at 760 mmHg |
|---|
| Molecular Formula | C13H18O3 |
|---|
| Molecular Weight | 222.28000 |
|---|
| Flash Point | 119.8ºC |
|---|
| Exact Mass | 222.12600 |
|---|
| PSA | 35.53000 |
|---|
| LogP | 2.53590 |
|---|
| Vapour Pressure | 0.00151mmHg at 25°C |
|---|
| Index of Refraction | 1.487 |
|---|
| InChIKey | ZISVYKNZALCDGC-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(C)(C)c1ccc(OC)cc1 |
|---|
Synonyms
| 2-<4-Methoxy-phenyl>-propan-carbonsaeure-(2)-aethylester |
| 2-(4-Methoxy-phenyl)-2-methyl-propionsaeure-aethylester |
| 2-(4-Methoxy-phenyl)-2-methyl-propionsaeure-ethylester |
| 2-(4-methoxy-phenyl)-2-methyl-propionic acid ethyl ester |
