Introduction：Basic information about CAS 60532-63-0|Tetrakis(4-aminophenyl)methane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tetrakis(4-aminophenyl)methane |
|---|
| CAS Number | 60532-63-0 | Molecular Weight | 380.485 |
|---|
| Density | 1.247±0.06 g/cm3 | Boiling Point | 639.7±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C25H24N4 | Melting Point | 262 ºC |
|---|
| MSDS | / | Flash Point | 381.8±28.4 °C |
|---|
Names
| Name | 4-[tris(4-aminophenyl)methyl]aniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.247±0.06 g/cm3 |
|---|
| Boiling Point | 639.7±55.0 °C at 760 mmHg |
|---|
| Melting Point | 262 ºC |
|---|
| Molecular Formula | C25H24N4 |
|---|
| Molecular Weight | 380.485 |
|---|
| Flash Point | 381.8±28.4 °C |
|---|
| Exact Mass | 380.200104 |
|---|
| PSA | 104.08000 |
|---|
| LogP | 2.18 |
|---|
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.723 |
|---|
| InChIKey | LNHGLSRCOBIHNV-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc(C(c2ccc(N)cc2)(c2ccc(N)cc2)c2ccc(N)cc2)cc1 |
|---|
| Water Solubility | Insuluble (2.2E-3 g/L) (25 ºC) |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | 22-36 |
|---|
| Safety Phrases | 26 |
|---|
Synonyms
| tetra(4-aminophenyl)methane |
| Benzenamine, 4,4',4'',4'''-methanetetrayltetrakis- |
| Tetrakis(4-aminophenyl)methane |
| tetrakis(p-aminophenyl)methane |
| 4,4',4'',4'''-Methanetetrayltetraaniline |
| tetra(p-aminophenyl)methane |
| Benzenamine,4,4',4'',4'''-methanetetrayltetrakis |
