Introduction：Basic information about CAS 66556-77-2|acenocoumarol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | acenocoumarol |
|---|
| CAS Number | 66556-77-2 | Molecular Weight | 353.326 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 592.7±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H15NO6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 312.3±30.1 °C |
|---|
Names
| Name | (R)-acenocoumarol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 592.7±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H15NO6 |
|---|
| Molecular Weight | 353.326 |
|---|
| Flash Point | 312.3±30.1 °C |
|---|
| Exact Mass | 353.089935 |
|---|
| PSA | 113.33000 |
|---|
| LogP | 3.15 |
|---|
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.656 |
|---|
| InChIKey | VABCILAOYCMVPS-OAHLLOKOSA-N |
|---|
| SMILES | CC(=O)CC(c1ccc([N+](=O)[O-])cc1)c1c(O)c2ccccc2oc1=O |
|---|
Synonyms
| UNII:I6WP63U32H |
| 4-Hydroxy-3-[1-(4-nitrophenyl)-3-oxobutyl]-2H-chromen-2-one |
| Trombostop |
| 4-hydroxy-3-[(1R)-1-(4-nitrophenyl)-3-oxobutyl]chromen-2-one |
| (R)-Acenocoumarol |
| 2H-1-Benzopyran-2-one, 4-hydroxy-3-[1-(4-nitrophenyl)-3-oxobutyl]- |
| 2H-1-Benzopyran-2-one, 4-hydroxy-3-(1-(4-nitrophenyl)-3-oxobutyl)- |
| 2H-1-Benzopyran-2-one, 4-hydroxy-3-(1-(4-nitrophenyl)-3-oxobutyl)-, (±)- |
| 3-(a-Acetonyl-p-nitrobenzyl)-4-hydroxycoumarin |
| 4-Hydroxy-3-[1-(4-nitrophenyl)-3-oxobutyl]-2H-1-benzopyran-2-one |
| acenocoumarol |
| 3-(a-p-Nitrophenyl-b-acetylethyl)-4-hydroxycoumarin |
