Introduction:Basic information about CAS 109371-33-7|(S)-(-)-1,1-BINAPHTHYL-2,2-DIAMINE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (S)-(-)-1,1-BINAPHTHYL-2,2-DIAMINE |
|---|
| CAS Number | 109371-33-7 | Molecular Weight | 440.50900 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C24H24O6S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | [(2S)-3-(4-methylphenyl)sulfonyloxy-2-phenylmethoxypropyl] benzoate |
|---|
Chemical & Physical Properties
| Molecular Formula | C24H24O6S |
|---|
| Molecular Weight | 440.50900 |
|---|
| Exact Mass | 440.12900 |
|---|
| PSA | 87.28000 |
|---|
| LogP | 5.22350 |
|---|
| Index of Refraction | 1.584 |
|---|
| InChIKey | PXMMPVOAHGXZSG-QFIPXVFZSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)OCC(COC(=O)c2ccccc2)OCc2ccccc2)cc1 |
|---|
Safety Information