Introduction:Basic information about CAS 669713-97-7|3-(2'-N-BOC-PYRROLE)BENZOICACID, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(2'-N-BOC-PYRROLE)BENZOICACID |
|---|
| CAS Number | 669713-97-7 | Molecular Weight | 287.31000 |
|---|
| Density | 1.17g/cm3 | Boiling Point | 469.6ºC at 760 mmHg |
|---|
| Molecular Formula | C16H17NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 237.8ºC |
|---|
Names
| Name | 3-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrol-2-yl]benzoic acid |
|---|
Chemical & Physical Properties
| Density | 1.17g/cm3 |
|---|
| Boiling Point | 469.6ºC at 760 mmHg |
|---|
| Molecular Formula | C16H17NO4 |
|---|
| Molecular Weight | 287.31000 |
|---|
| Flash Point | 237.8ºC |
|---|
| Exact Mass | 287.11600 |
|---|
| PSA | 68.53000 |
|---|
| LogP | 3.63650 |
|---|
| Index of Refraction | 1.558 |
|---|
| InChIKey | NHZAONBMGJNOGP-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)n1cccc1-c1cccc(C(=O)O)c1 |
|---|