Introduction：Basic information about CAS 886363-54-8|2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]acetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]acetic acid |
|---|
| CAS Number | 886363-54-8 | Molecular Weight | 280.43500 |
|---|
| Density | 1.022g/cm3 | Boiling Point | 363.1ºC at 760 mmHg |
|---|
| Molecular Formula | C15H24O3Si | Melting Point | / |
|---|
| MSDS | / | Flash Point | 173.4ºC |
|---|
Names
| Name | 2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.022g/cm3 |
|---|
| Boiling Point | 363.1ºC at 760 mmHg |
|---|
| Molecular Formula | C15H24O3Si |
|---|
| Molecular Weight | 280.43500 |
|---|
| Flash Point | 173.4ºC |
|---|
| Exact Mass | 280.14900 |
|---|
| PSA | 46.53000 |
|---|
| LogP | 3.83550 |
|---|
| Index of Refraction | 1.498 |
|---|
| InChIKey | XQWYZOLEWPQRES-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccc(CC(=O)O)cc1 |
|---|
Synonyms
| [4-(tert-Butyl-dimethyl-silanyloxymethyl)phenyl] |
| 2-[4-[(tert-butyl-dimethyl-silyl)oxymethyl]phenyl]acetic acid |
| [4-(tert-butyl-dimethyl-silanyloxymethyl) phenyl]-acetic acid |
