Introduction：Basic information about CAS 90-25-5|1-chloro-3,5-dimethoxy-2-nitrobenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-chloro-3,5-dimethoxy-2-nitrobenzene |
|---|
| CAS Number | 90-25-5 | Molecular Weight | 131.17400 |
|---|
| Density | 1.349g/cm3 | Boiling Point | 352.2ºC at 760 mmHg |
|---|
| Molecular Formula | C9H9N | Melting Point | 158.5ºC |
|---|
| MSDS | / | Flash Point | 166.8ºC |
|---|
Names
| Name | 5-Chlor-4-nitro-resorcin-dimethylaether |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.349g/cm3 |
|---|
| Boiling Point | 352.2ºC at 760 mmHg |
|---|
| Melting Point | 158.5ºC |
|---|
| Molecular Formula | C9H9N |
|---|
| Molecular Weight | 131.17400 |
|---|
| Flash Point | 166.8ºC |
|---|
| Exact Mass | 131.07300 |
|---|
| PSA | 15.79000 |
|---|
| LogP | 2.47630 |
|---|
| Index of Refraction | 1.545 |
|---|
| InChIKey | VHLPIOGWYXZJJT-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(Cl)c([N+](=O)[O-])c(OC)c1 |
|---|
Synonyms
| 1-Chlor-3,5-difluor-benzol |
| 3,5-difluorochlorobenzene |
| chloro-dimethoxynitrobenzene |
| 1-chloro-3,5-difluoro-benzene |
| 1-Chlor-3,5-dimethoxy-2-nitro-benzol |
| 1-chloro-3,5-dimethoxy-2-nitro-benzene |
