Introduction：Basic information about CAS 90271-37-7|2-(3-Nitrophenyl)ethanamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(3-Nitrophenyl)ethanamine |
|---|
| CAS Number | 90271-37-7 | Molecular Weight | 166.177 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 264.8±23.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H10N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 113.9±22.6 °C |
|---|
Names
| Name | 1-(3-nitro-phenyl)-ethylamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 264.8±23.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H10N2O2 |
|---|
| Molecular Weight | 166.177 |
|---|
| Flash Point | 113.9±22.6 °C |
|---|
| Exact Mass | 166.074234 |
|---|
| PSA | 71.84000 |
|---|
| LogP | 1.17 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.577 |
|---|
| InChIKey | AVIBPONLEKDCPQ-UHFFFAOYSA-N |
|---|
| SMILES | CC(N)c1cccc([N+](=O)[O-])c1 |
|---|
Safety Information
Customs
| HS Code | 2921499090 |
|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 3,4-dihydro-6,7-dimethoxy-1-(3-nitrophenyl)-1H-isochromene |
| 1-(3-nitro-phenyl)-ethanone-(2,4-dinitro-phenylhydrazone) |
| (+-)-1-(3-nitro-phenyl)-ethylamine |
| 2-(3-Nitrophenyl)ethanamine |
| 1-(3-nitropenyl)ethylamine |
| 1H-2-Benzopyran,3,4-dihydro-6,7-dimethoxy-1-(3-nitrophenyl) |
| m-Nitroacetophenone oxime methyl ether |
| 1-(3-Nitro-phenyl)-aethanon-(2,4-dinitro-phenylhydrazon) |
| 1-(3-nitro-phenyl)-ethanone-(O-methyl oxime ) |
| Benzenemethanamine, α-methyl-3-nitro- |
| Benzylamine, α-methyl-m-nitro- |
| 1-(3-Nitrophenyl)ethanamine |
| 3'-nitroacetophenone 2,4-dinitrophenylhydrazone |
| 1-(3-Nitro-phenyl)-ethylamine |
| 2.4-Dinitrophenylhydrazon des m-Nitro-acetophenons |
| Benzeneethanamine, 3-nitro- |
| <m-Nitroacetophenon>-2.4-dinitrophenylhydrazon |
| 1-(3-Nitro-phenyl)-aethanon-(O-methyl-oxim) |
| 1-(3-nitrophenyl)-isochroman |
| 1-(3-nitro-phenyl)-ethanone semicarbazone |
| m-NO2C6H4CH(CH3)NH2 |
| 1-(3-Nitro-phenyl)-aethanon-semicarbazon |
| 1-(3'-nitrophenyl)-6,7-dimethoxyisochroman |
| 3-Nitro-acetophenon-<2.4-dinitro-phenylhydrazon> |
