Introduction：Basic information about CAS 239088-22-3|9H-Fluoren-9-ylmethyl decyl(2-oxoethyl)carbamate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 9H-Fluoren-9-ylmethyl decyl(2-oxoethyl)carbamate |
|---|
| CAS Number | 239088-22-3 | Molecular Weight | 421.572 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 550.6±29.0 °C at 760 mmHg |
|---|
| Molecular Formula | C27H35NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 286.8±24.3 °C |
|---|
Names
| Name | 9H-fluoren-9-ylmethyl N-decyl-N-(2-oxoethyl)carbamate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 550.6±29.0 °C at 760 mmHg |
|---|
| Molecular Formula | C27H35NO3 |
|---|
| Molecular Weight | 421.572 |
|---|
| Flash Point | 286.8±24.3 °C |
|---|
| Exact Mass | 421.261688 |
|---|
| PSA | 46.61000 |
|---|
| LogP | 8.60 |
|---|
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.547 |
|---|
| InChIKey | AWGULBUAOMFSCY-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCCCCCCN(CC=O)C(=O)OCC1c2ccccc2-c2ccccc21 |
|---|
Synonyms
| 9H-Fluoren-9-ylmethyl decyl(2-oxoethyl)carbamate |
| N-Fmoc-2-(n-decylamino)acetaldehyde |
| 9H-fluoren-9-ylmethyl esterdecyl (2-oxoethyl)-carbamic acid |
| (9H-Fluoren-9-yl)methyl decyl(2-oxoethyl)carbamate |
| N-Fmoc-Decylaminoacetaldehyde |
| FD6005 |
| Carbamic acid, N-decyl-N-(2-oxoethyl)-, 9H-fluoren-9-ylmethyl ester |
| M-Foc-amino aldehyde |
| N-Fmoc-N-decylaminoacetaldehyde |
