Introduction：Basic information about CAS 29117-08-6|Poly(ethyleneglycol) 2-[ethyl[(heptadecafluorooctyl)sulfonyl]amino]ethyl ether, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Poly(ethyleneglycol) 2-[ethyl[(heptadecafluorooctyl)sulfonyl]amino]ethyl ether |
|---|
| CAS Number | 29117-08-6 | Molecular Weight | 615.30300 |
|---|
| Density | 1.32 | Boiling Point | 210ºC |
|---|
| Molecular Formula | C14H14F17NO4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | >110ºC |
|---|
Names
| Name | N-Ethyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-[2-(2 -hydroxyethoxy)ethyl]-1-octanesulfonamide |
|---|
Chemical & Physical Properties
| Density | 1.32 |
|---|
| Boiling Point | 210ºC |
|---|
| Molecular Formula | C14H14F17NO4S |
|---|
| Molecular Weight | 615.30300 |
|---|
| Flash Point | >110ºC |
|---|
| Exact Mass | 615.03700 |
|---|
| PSA | 75.22000 |
|---|
| LogP | 5.69470 |
|---|
| Index of Refraction | 1.427 |
|---|
| InChIKey | PITHXNPHTSFHSW-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CCOCCO)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|
