Introduction:Basic information about CAS 2749-28-2|2-O-Acetyltutin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-O-Acetyltutin |
|---|
| CAS Number | 2749-28-2 | Molecular Weight | 336.336 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 518.6±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H20O7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 191.8±23.6 °C |
|---|
Names
| Name | (2R,3S,5R,6R,7R,8R)-2-Hydroxy-12-isopropenyl-7-methyl-11-oxospiro[4,10-dioxatetracyclo[7.2.1.02,7.03,5]dodecane-6,2'-oxiran]-8-yl acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 518.6±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H20O7 |
|---|
| Molecular Weight | 336.336 |
|---|
| Flash Point | 191.8±23.6 °C |
|---|
| Exact Mass | 336.120911 |
|---|
| PSA | 97.89000 |
|---|
| LogP | 1.15 |
|---|
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.598 |
|---|
| InChIKey | UUEQFDNPPWQXQE-UHFFFAOYSA-N |
|---|
| SMILES | C=C(C)C1C2OC(=O)C1C1(O)C3OC3C3(CO3)C1(C)C2OC(C)=O |
|---|
Synonyms
| acetyladamantane |
| 1-adamantyl methyl ketone |
| (1S,2R,3S,5R,6R,7R,8S,9R,12R)-2-Hydroxy-12-isopropenyl-7-methyl-11-oxospiro[4,10-dioxatetracyclo[7.2.1.0.0]dodecane-6,2'-oxiran]-8-yl acetate |
| Adamantyl Metyl Ketone |
| Adamantanemethylketone |
| 1-ACETYLADAMANTANE |
| IFLAB-BB F1928-0002 |
| 1-Acetyltutin |
| adamantan-1-yl-ethan-1-one |
| Adamantyl methyl ketone |