Introduction:Basic information about CAS 3204-68-0|N-Benzyl-N,N-dimethylanilinium chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-Benzyl-N,N-dimethylanilinium chloride |
|---|
| CAS Number | 3204-68-0 | Molecular Weight | 247.763 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C15H18ClN | Melting Point | 134-138ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | benzyl-dimethyl-phenylazanium,chloride |
|---|
| Synonym | More Synonyms |
|---|
N-Benzyl-N,N-dimethylanilinium chloride BiologicalActivity
| Description | N-Benzyl-N,N-dimethylbenzenaminium chloride is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|
| Related Catalog | Research Areas >>Others |
|---|
Chemical & Physical Properties
| Melting Point | 134-138ºC |
|---|
| Molecular Formula | C15H18ClN |
|---|
| Molecular Weight | 247.763 |
|---|
| Exact Mass | 247.112778 |
|---|
| LogP | 0.45770 |
|---|
| InChIKey | QLRKASHXFNIPLZ-UHFFFAOYSA-M |
|---|
| SMILES | C[N+](C)(Cc1ccccc1)c1ccccc1.[Cl-] |
|---|
| Water Solubility | almost transparency |
|---|
Safety Information
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| HS Code | 2923900090 |
|---|
Customs
| HS Code | 2923900090 |
|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Leucotrope O |
| Dimethylbenzylphenylammonium Chloride |
| Benzyldimethylanilinium chloride |
| benzyl(dimethyl)phenylammonium chloride |
| Dimethylbenzylanilinium chloride |
| Benzenemethanaminium, N,N-dimethyl-N-phenyl-, chloride (1:1) |
| Benzyldimethylphenylammonium chloride |
| Phenylbenzyldimethylammonium Chloride |
| phenyl-benzyl-dimethylammonium chloride |
| Phenyldimethylbenzylammonium chloride |
| Leukotrope |
| (benzyl)-(phenyl)-di(methyl)-ammonium chloride |
| N-Benzyl-N,N-dimethylanilinium chloride |
| EINECS 221-707-2 |
| Benzenemethanaminium, N,N-dimethyl-N-phenyl-, chloride |
| Dimethylphenylbenzylammonium chloride |
| N,N-dimethyl N-benzyl N-phenyl ammonium chloride |