Introduction:Basic information about CAS 6668-56-0|4-Fluoro-3-nitrobenzenesulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Fluoro-3-nitrobenzenesulfonyl chloride |
|---|
| CAS Number | 6668-56-0 | Molecular Weight | 239.609 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 362.9±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H3ClFNO4S | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 173.3±23.7 °C |
|---|
Names
| Name | 4-Fluoro-3-nitrobenzenesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 362.9±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H3ClFNO4S |
|---|
| Molecular Weight | 239.609 |
|---|
| Flash Point | 173.3±23.7 °C |
|---|
| Exact Mass | 238.945526 |
|---|
| PSA | 88.34000 |
|---|
| LogP | 2.21 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.569 |
|---|
| InChIKey | RRONENSZKCGROA-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)Cl)ccc1F |
|---|
Safety Information
| Hazard Codes | C |
|---|
| HS Code | 2904909090 |
|---|
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| chloro(4-fluoro-3-nitrophenyl)sulfone |
| 4-Fluoro-3-nitrobenzenesulfonyl chloride |
| 4-Fluoro-3-nitrobenzenesulphonyl chloride |
| 4-fluoro-3-nitrobenzene-1-sulfonyl chloride |
| Benzenesulfonyl chloride, 4-fluoro-3-nitro- |
| 4-fluoro-3-nitrophenylsulfonyl chloride |
| 3-nitro-4-fluorobenzenesulfonyl chloride |