Introduction:Basic information about CAS 121784-20-1|Methyl 4-acetoxy-8-methyl-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 4-acetoxy-8-methyl-2-naphthoate |
|---|
| CAS Number | 121784-20-1 | Molecular Weight | 258.26900 |
|---|
| Density | 1.199g/cm3 | Boiling Point | 408.6ºC at 760 mmHg |
|---|
| Molecular Formula | C15H14O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 207.4ºC |
|---|
Names
| Name | Methyl 4-acetoxy-8-methyl-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.199g/cm3 |
|---|
| Boiling Point | 408.6ºC at 760 mmHg |
|---|
| Molecular Formula | C15H14O4 |
|---|
| Molecular Weight | 258.26900 |
|---|
| Flash Point | 207.4ºC |
|---|
| Exact Mass | 258.08900 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 2.86010 |
|---|
| Vapour Pressure | 6.94E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.583 |
|---|
| InChIKey | QECNCAMQRJALOV-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(OC(C)=O)c2cccc(C)c2c1 |
|---|