Introduction:Basic information about CAS 127265-99-0|Methyl 8-chloro-4-hydroxy-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 8-chloro-4-hydroxy-2-naphthoate |
|---|
| CAS Number | 127265-99-0 | Molecular Weight | 236.65100 |
|---|
| Density | 1.377g/cm3 | Boiling Point | 424.2ºC at 760 mmHg |
|---|
| Molecular Formula | C12H9ClO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 210.4ºC |
|---|
Names
| Name | Methyl 8-chloro-4-hydroxy-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.377g/cm3 |
|---|
| Boiling Point | 424.2ºC at 760 mmHg |
|---|
| Molecular Formula | C12H9ClO3 |
|---|
| Molecular Weight | 236.65100 |
|---|
| Flash Point | 210.4ºC |
|---|
| Exact Mass | 236.02400 |
|---|
| PSA | 46.53000 |
|---|
| LogP | 2.98540 |
|---|
| Vapour Pressure | 8.5E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.649 |
|---|
| InChIKey | KVGWWTHPCSVNDM-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(O)c2cccc(Cl)c2c1 |
|---|