Introduction:Basic information about CAS 173445-39-1|3-[3-Methyl-5-(2-methyl-2-propanyl)phenyl]propanal, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-[3-Methyl-5-(2-methyl-2-propanyl)phenyl]propanal |
|---|
| CAS Number | 173445-39-1 | Molecular Weight | 204.30800 |
|---|
| Density | / | Boiling Point | 272.1ºC at 760 mmHg |
|---|
| Molecular Formula | C14H20O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 116ºC |
|---|
Names
| Name | 3-[3-Methyl-5-(2-methyl-2-propanyl)phenyl]propanal |
|---|
Chemical & Physical Properties
| Boiling Point | 272.1ºC at 760 mmHg |
|---|
| Molecular Formula | C14H20O |
|---|
| Molecular Weight | 204.30800 |
|---|
| Flash Point | 116ºC |
|---|
| Exact Mass | 204.15100 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 3.42400 |
|---|
| Vapour Pressure | 0.00619mmHg at 25°C |
|---|
| Index of Refraction | 1.494 |
|---|
| InChIKey | YYMDVFBICNBATN-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(CCC=O)cc(C(C)(C)C)c1 |
|---|