Introduction：Basic information about CAS 67643-43-0|6,8-Dibromo-4-hydroxy-5-methyl-3-quinolinecarbonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6,8-Dibromo-4-hydroxy-5-methyl-3-quinolinecarbonitrile |
|---|
| CAS Number | 67643-43-0 | Molecular Weight | 341.98600 |
|---|
| Density | 2.05g/cm3 | Boiling Point | 494.6ºC at 760 mmHg |
|---|
| Molecular Formula | C11H6Br2N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 252.9ºC |
|---|
Names
| Name | 6,8-Dibromo-4-hydroxy-5-methyl-3-quinolinecarbonitrile |
|---|
Chemical & Physical Properties
| Density | 2.05g/cm3 |
|---|
| Boiling Point | 494.6ºC at 760 mmHg |
|---|
| Molecular Formula | C11H6Br2N2O |
|---|
| Molecular Weight | 341.98600 |
|---|
| Flash Point | 252.9ºC |
|---|
| Exact Mass | 339.88500 |
|---|
| PSA | 56.65000 |
|---|
| LogP | 3.23318 |
|---|
| Index of Refraction | 1.758 |
|---|
| InChIKey | CHYUXOMQMPNCSK-UHFFFAOYSA-N |
|---|
| SMILES | Cc1c(Br)cc(Br)c2[nH]cc(C#N)c(=O)c12 |
|---|
