Introduction：Basic information about CAS 67643-44-1|5-Bromo-4-hydroxy-8-methoxy-3-quinolinecarbonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Bromo-4-hydroxy-8-methoxy-3-quinolinecarbonitrile |
|---|
| CAS Number | 67643-44-1 | Molecular Weight | 279.08900 |
|---|
| Density | 1.74g/cm3 | Boiling Point | 472.6ºC at 760 mmHg |
|---|
| Molecular Formula | C11H7BrN2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 239.6ºC |
|---|
Names
| Name | 5-Bromo-4-hydroxy-8-methoxy-3-quinolinecarbonitrile |
|---|
Chemical & Physical Properties
| Density | 1.74g/cm3 |
|---|
| Boiling Point | 472.6ºC at 760 mmHg |
|---|
| Molecular Formula | C11H7BrN2O2 |
|---|
| Molecular Weight | 279.08900 |
|---|
| Flash Point | 239.6ºC |
|---|
| Exact Mass | 277.96900 |
|---|
| PSA | 65.88000 |
|---|
| LogP | 2.17088 |
|---|
| Index of Refraction | 1.709 |
|---|
| InChIKey | IVSWNIKCMXITTO-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(Br)c2c(=O)c(C#N)c[nH]c12 |
|---|
