Introduction：Basic information about CAS 67643-45-2|5-Bromo-8-ethoxy-4-hydroxy-3-quinolinecarbonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Bromo-8-ethoxy-4-hydroxy-3-quinolinecarbonitrile |
|---|
| CAS Number | 67643-45-2 | Molecular Weight | 293.11600 |
|---|
| Density | 1.66g/cm3 | Boiling Point | 476.3ºC at 760 mmHg |
|---|
| Molecular Formula | C12H9BrN2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 241.9ºC |
|---|
Names
| Name | 5-Bromo-8-ethoxy-4-hydroxy-3-quinolinecarbonitrile |
|---|
Chemical & Physical Properties
| Density | 1.66g/cm3 |
|---|
| Boiling Point | 476.3ºC at 760 mmHg |
|---|
| Molecular Formula | C12H9BrN2O2 |
|---|
| Molecular Weight | 293.11600 |
|---|
| Flash Point | 241.9ºC |
|---|
| Exact Mass | 291.98500 |
|---|
| PSA | 65.88000 |
|---|
| LogP | 2.56098 |
|---|
| Index of Refraction | 1.686 |
|---|
| InChIKey | FGVXCFOJBNGZFV-UHFFFAOYSA-N |
|---|
| SMILES | CCOc1ccc(Br)c2c(=O)c(C#N)c[nH]c12 |
|---|
