Introduction:Basic information about CAS 320-76-3|4-Bromo-2-fluoro-6-nitrophenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Bromo-2-fluoro-6-nitrophenol |
|---|
| CAS Number | 320-76-3 | Molecular Weight | 235.99500 |
|---|
| Density | 1.965g/cm3 | Boiling Point | 241.4ºC at 760mmHg |
|---|
| Molecular Formula | C6H3BrFNO3 | Melting Point | 63-65 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 99.8ºC |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 4-Bromo-2-fluoro-6-nitrophenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.965g/cm3 |
|---|
| Boiling Point | 241.4ºC at 760mmHg |
|---|
| Melting Point | 63-65 °C(lit.) |
|---|
| Molecular Formula | C6H3BrFNO3 |
|---|
| Molecular Weight | 235.99500 |
|---|
| Flash Point | 99.8ºC |
|---|
| Exact Mass | 234.92800 |
|---|
| PSA | 66.05000 |
|---|
| LogP | 2.72520 |
|---|
| Index of Refraction | 1.623 |
|---|
| InChIKey | ACQVEWFMUBXEMR-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1cc(Br)cc(F)c1O |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302 + H312 + H332-H315-H319-H335 |
|---|
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xn: Harmful; |
|---|
| Risk Phrases | R20/21/22;R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2908999090 |
|---|
Customs
| HS Code | 2908999090 |
|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 4-Brom-2-fluor-6-nitro-phenol |
| MFCD00013372 |
| 2-fluoro-4-bromo-6-nitro-phenol |
| 6-Fluor-4-brom-2-nitro-1-hydroxy-benzol |
| bromo-4 fluoro-2 nitro-6 phenol |
| 4-bromo-2-fluoro 6-nitrophenol |