Introduction：Basic information about CAS 724788-41-4|3-bromo-6-methoxy-1H-quinolin-4-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-bromo-6-methoxy-1H-quinolin-4-one |
|---|
| CAS Number | 724788-41-4 | Molecular Weight | 254.08000 |
|---|
| Density | 1.603g/cm3 | Boiling Point | 347ºC at 760 mmHg |
|---|
| Molecular Formula | C10H8BrNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 163.7ºC |
|---|
Names
| Name | 3-bromo-6-methoxy-1H-quinolin-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.603g/cm3 |
|---|
| Boiling Point | 347ºC at 760 mmHg |
|---|
| Molecular Formula | C10H8BrNO2 |
|---|
| Molecular Weight | 254.08000 |
|---|
| Flash Point | 163.7ºC |
|---|
| Exact Mass | 252.97400 |
|---|
| PSA | 42.09000 |
|---|
| LogP | 2.29920 |
|---|
| Index of Refraction | 1.624 |
|---|
| InChIKey | NEYZMCYOOQBXLS-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc2[nH]cc(Br)c(=O)c2c1 |
|---|
Synonyms
| 3-Bromo-4-hydroxy-6-methoxyquinoline |
| 3-Bromo-6-methoxy-4-quinolone |
