Introduction：Basic information about CAS 100927-14-8|Befiperide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Befiperide |
|---|
| CAS Number | 100927-14-8 | Molecular Weight | 405.53300 |
|---|
| Density | 1.135g/cm3 | Boiling Point | 576.6ºC at 760 mmHg |
|---|
| Molecular Formula | C25H31N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 302.5ºC |
|---|
Names
| Name | N-[2-[4-(1-benzofuran-7-yl)piperazin-1-yl]ethyl]-N-methyl-4-propan-2-ylbenzamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.135g/cm3 |
|---|
| Boiling Point | 576.6ºC at 760 mmHg |
|---|
| Molecular Formula | C25H31N3O2 |
|---|
| Molecular Weight | 405.53300 |
|---|
| Flash Point | 302.5ºC |
|---|
| Exact Mass | 405.24200 |
|---|
| PSA | 39.93000 |
|---|
| LogP | 4.45330 |
|---|
| Vapour Pressure | 2.69E-13mmHg at 25°C |
|---|
| Index of Refraction | 1.596 |
|---|
| InChIKey | XZHMFCUWVDUYBV-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)c1ccc(C(=O)N(C)CCN2CCN(c3cccc4ccoc34)CC2)cc1 |
|---|
Synonyms
| N-(2-(4-(7-Benzofuranoyl)-1-piperazinyl)ethyl)-p-isopropyl-N-methylbenzamide |
| UNII-Q6353VLJ8E |
| Befiperide [INN] |
