Introduction：Basic information about CAS 120824-08-0|linotroban, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | linotroban |
|---|
| CAS Number | 120824-08-0 | Molecular Weight | 341.40300 |
|---|
| Density | 1.411g/cm3 | Boiling Point | 558.8ºC at 760mmHg |
|---|
| Molecular Formula | C14H15NO5S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 291.7ºC |
|---|
Names
| Name | [(5-{2-[(Phenylsulfonyl)amino]ethyl}-2-thienyl)oxy]acetic acid |
|---|
Chemical & Physical Properties
| Density | 1.411g/cm3 |
|---|
| Boiling Point | 558.8ºC at 760mmHg |
|---|
| Molecular Formula | C14H15NO5S2 |
|---|
| Molecular Weight | 341.40300 |
|---|
| Flash Point | 291.7ºC |
|---|
| Exact Mass | 341.03900 |
|---|
| PSA | 129.32000 |
|---|
| LogP | 3.20420 |
|---|
| Vapour Pressure | 2.54E-13mmHg at 25°C |
|---|
| Index of Refraction | 1.611 |
|---|
| InChIKey | ISSKMEQROMFEHL-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)COc1ccc(CCNS(=O)(=O)c2ccccc2)s1 |
|---|
