Introduction：Basic information about CAS 388-51-2|Metofenazate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Metofenazate |
|---|
| CAS Number | 388-51-2 | Molecular Weight | 598.15300 |
|---|
| Density | 1.248 g/cm3 | Boiling Point | 694.7ºC at 760 mmHg |
|---|
| Molecular Formula | C31H36ClN3O5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 374ºC |
|---|
Names
| Name | metofenazate |
|---|
| Synonym | More Synonyms |
|---|
Metofenazate BiologicalActivity
| Description | Metofenazate is a selective calmodulin inhibitor. |
|---|
| Related Catalog | Signaling Pathways >>Neuronal Signaling >>CaMKResearch Areas >>Neurological Disease |
|---|
| Target | Calmodulin[1] |
|---|
| References | [1]. Tkachuk VA, et al. Metofenazate as a more selective calmodulin inhibitor than trifluoperazine. Arzneimittelforschung. 1987 Sep;37(9):1013-7. |
|---|
Chemical & Physical Properties
| Density | 1.248 g/cm3 |
|---|
| Boiling Point | 694.7ºC at 760 mmHg |
|---|
| Molecular Formula | C31H36ClN3O5S |
|---|
| Molecular Weight | 598.15300 |
|---|
| Flash Point | 374ºC |
|---|
| Exact Mass | 597.20600 |
|---|
| PSA | 89.01000 |
|---|
| LogP | 5.77400 |
|---|
| Index of Refraction | 1.6 |
|---|
| InChIKey | BAQLUVXNKOTTHU-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(C(=O)OCCN2CCN(CCCN3c4ccccc4Sc4ccc(Cl)cc43)CC2)cc(OC)c1OC |
|---|
| Storage condition | 2-8℃ |
|---|
Synonyms
| 2-[4-[3-(2-chlorophenothiazin-10-yl)propyl]piperazin-1-yl]ethyl 3,4,5-trimethoxybenzoate |
| Metofenazate [INN] |
| 1-<2-(3,4,5-Trimethoxy-benzoyloxy)-ethyl>-4-(3-<2-chlor-phenothiazinyl-(10)>-propyl)-piperazin |
| Metofenazatum |
| Metofenazato [INN-Spanish] |
| Frenolon |
| Metofenazatum [INN-Latin] |
| 1-(3-<2-Chlor-phenothiazinyl-(10)>-propyl)-4-<2-(3,4,5-trimethoxy-benzoyloxy)-ethyl>-piperazin |
| Metofenazato |
| Methophenazine |
| perphenazine |
| 3,4,5-trimethoxy-benzoic acid 2-{4-[3-(2-chloro-phenothiazin-10-yl)-propyl]-piperazin-1-yl}-ethyl ester |
