Introduction：Basic information about CAS 99362-95-5|methyl 2-[(4-aminophenyl)sulfonylamino]acetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | methyl 2-[(4-aminophenyl)sulfonylamino]acetate |
|---|
| CAS Number | 99362-95-5 | Molecular Weight | 244.26800 |
|---|
| Density | 1.366g/cm3 | Boiling Point | 428.2ºC at 760mmHg |
|---|
| Molecular Formula | C9H12N2O4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 212.8ºC |
|---|
Names
| Name | methyl 2-[(4-aminophenyl)sulfonylamino]acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.366g/cm3 |
|---|
| Boiling Point | 428.2ºC at 760mmHg |
|---|
| Molecular Formula | C9H12N2O4S |
|---|
| Molecular Weight | 244.26800 |
|---|
| Flash Point | 212.8ºC |
|---|
| Exact Mass | 244.05200 |
|---|
| PSA | 106.87000 |
|---|
| LogP | 1.77300 |
|---|
| Index of Refraction | 1.569 |
|---|
| InChIKey | ZOWMDAHNZAIHGK-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)CNS(=O)(=O)c1ccc(N)cc1 |
|---|
Synonyms
| methyl {[(4-aminophenyl)sulfonyl]amino}acetate |
| N-Sulfanilyl-glycin-methylester |
| N-sulfanilyl-glycine methyl ester |
