Introduction：Basic information about CAS 62064-73-7|N-(β-Methoxy-m-trifluoromethylphenethyl)carbamic acid ethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(β-Methoxy-m-trifluoromethylphenethyl)carbamic acid ethyl ester |
|---|
| CAS Number | 62064-73-7 | Molecular Weight | 291.26600 |
|---|
| Density | 1.207g/cm3 | Boiling Point | 337.3ºC at 760 mmHg |
|---|
| Molecular Formula | C13H16F3NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 157.8ºC |
|---|
Names
| Name | ethyl N-[2-methoxy-2-[3-(trifluoromethyl)phenyl]ethyl]carbamate |
|---|
Chemical & Physical Properties
| Density | 1.207g/cm3 |
|---|
| Boiling Point | 337.3ºC at 760 mmHg |
|---|
| Molecular Formula | C13H16F3NO3 |
|---|
| Molecular Weight | 291.26600 |
|---|
| Flash Point | 157.8ºC |
|---|
| Exact Mass | 291.10800 |
|---|
| PSA | 51.05000 |
|---|
| LogP | 3.34340 |
|---|
| Index of Refraction | 1.462 |
|---|
| InChIKey | HGVPRYBOGXQZDU-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)NCC(OC)c1cccc(C(F)(F)F)c1 |
|---|
