Introduction：Basic information about CAS 28558-32-9|Thiabendazole Hypophosphite, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Thiabendazole Hypophosphite |
|---|
| CAS Number | 28558-32-9 | Molecular Weight | 267.24400 |
|---|
| Density | 1.406g/cm3 | Boiling Point | 446ºC at 760mmHg |
|---|
| Molecular Formula | C10H10N3O2PS | Melting Point | 304-305ºC |
|---|
| MSDS | / | Flash Point | 226.2ºC |
|---|
Names
| Name | Thiabendazole Hypophosphite |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.406g/cm3 |
|---|
| Boiling Point | 446ºC at 760mmHg |
|---|
| Melting Point | 304-305ºC |
|---|
| Molecular Formula | C10H10N3O2PS |
|---|
| Molecular Weight | 267.24400 |
|---|
| Flash Point | 226.2ºC |
|---|
| Exact Mass | 267.02300 |
|---|
| PSA | 121.00000 |
|---|
| LogP | 2.19370 |
|---|
| InChIKey | WRCLPOMBSNHUQA-UHFFFAOYSA-N |
|---|
| SMILES | O=PO.c1ccc2[nH]c(-c3cscn3)nc2c1 |
|---|
Safety Information
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| Phosphinic acid,compd. with 2-(4-thiazolyl)-1H-benzimidazole (1:1) |
| 2-(4-Thiazolyl)benzimidazole,hypophosphite salt |
| Thiabendazole hypophosphite |
| Elmpro |
| Arbotect |
| 4-(1H-benzimidazol-2-yl)-1,3-thiazole,phosphenous acid |
| Arbotect 20-S |
| Storite Clear Liquid |
| Arbotect S |
| Benzimidazole,2-(4-thiazolyl)-,monophosphinate |
