Introduction：Basic information about CAS 74531-88-7|Tioxamast, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tioxamast |
|---|
| CAS Number | 74531-88-7 | Molecular Weight | 306.33700 |
|---|
| Density | 1.326g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C14H14N2O4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | ethyl 2-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.326g/cm3 |
|---|
| Molecular Formula | C14H14N2O4S |
|---|
| Molecular Weight | 306.33700 |
|---|
| Exact Mass | 306.06700 |
|---|
| PSA | 105.76000 |
|---|
| LogP | 2.39330 |
|---|
| Index of Refraction | 1.602 |
|---|
| InChIKey | ROVWYOFNUFLLNL-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(=O)Nc1nc(-c2ccc(OC)cc2)cs1 |
|---|
Synonyms
| Tioxamastum [Latin] |
| ethyl{[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino}(oxo)acetate |
| Ethyl ((4-(4-methoxyphenyl)-2-thiazolyl)amino)oxoacetate |
| Ethyl (4-(p-methoxyphenyl)-2-thiazolyl)oxamate |
| ethyl N-<4-(4-methoxyphenyl)-2-thiazolyl>oxamate |
| ethyl-N-(4-paramethoxyphenyl-2-thiazolyl)oxamate |
| Ethyl-(4-paramethoxyphenyl-2-thiazolyl)-oxamate |
| Tioxamast |
| F 1865 |
