Introduction：Basic information about CAS 32710-91-1|Trifezolac, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Trifezolac |
|---|
| CAS Number | 32710-91-1 | Molecular Weight | 354.40100 |
|---|
| Density | 1.18g/cm3 | Boiling Point | 592.3ºC at 760mmHg |
|---|
| Molecular Formula | C23H18N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 312ºC |
|---|
Names
| Name | 2-(1,3,5-triphenylpyrazol-4-yl)acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.18g/cm3 |
|---|
| Boiling Point | 592.3ºC at 760mmHg |
|---|
| Molecular Formula | C23H18N2O2 |
|---|
| Molecular Weight | 354.40100 |
|---|
| Flash Point | 312ºC |
|---|
| Exact Mass | 354.13700 |
|---|
| PSA | 55.12000 |
|---|
| LogP | 4.83340 |
|---|
| Index of Refraction | 1.635 |
|---|
| InChIKey | YBPNJBYPFNTZIW-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)Cc1c(-c2ccccc2)nn(-c2ccccc2)c1-c1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2933199090 |
|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| Trifezolac |
| 1H-Pyrazole-4-aceticacid,1,3,5-triphenyl |
| 1,3,5-triphenyl-pyrazol-4-acetic acid |
| (1,3,5-triphenyl-1H-pyrazol-4-yl)-acetic acid |
| 1,3,5-Triphenylpyrazol-4-essigsaeure |
| 1,3,5-triphenyl-4-pyrazolylacetic acid |
| Trifezolac [INN] |
| UNII-XJ3W180C22 |
