Introduction：Basic information about CAS 2419-54-7|Z-Asp(OBzl)-ONp, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Z-Asp(OBzl)-ONp |
|---|
| CAS Number | 2419-54-7 | Molecular Weight | 478.45100 |
|---|
| Density | 1.332g/cm3 | Boiling Point | 673.8ºC at 760 mmHg |
|---|
| Molecular Formula | C25H22N2O8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 361.3ºC |
|---|
Names
| Name | 4-Benzyl 1-(4-nitrophenyl) N-[(benzyloxy)carbonyl]-L-aspartate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.332g/cm3 |
|---|
| Boiling Point | 673.8ºC at 760 mmHg |
|---|
| Molecular Formula | C25H22N2O8 |
|---|
| Molecular Weight | 478.45100 |
|---|
| Flash Point | 361.3ºC |
|---|
| Exact Mass | 478.13800 |
|---|
| PSA | 140.24000 |
|---|
| LogP | 4.65630 |
|---|
| Vapour Pressure | 5.14E-18mmHg at 25°C |
|---|
| Index of Refraction | 1.603 |
|---|
| InChIKey | PDNCLFWZMMRDCA-QFIPXVFZSA-N |
|---|
| SMILES | O=C(CC(NC(=O)OCc1ccccc1)C(=O)Oc1ccc([N+](=O)[O-])cc1)OCc1ccccc1 |
|---|
Safety Information
Synonyms
| Rpi 312 |
| (S)-N-tert-butyl-3-[(2S,3S)-2-hydroxy-3-[(S)-2-benzyloxycarbonylaminosuccinamyl]amino-4-phenylbutanoyl]pyrrolidine-2-carboxamide |
| AHPBA 1a |
| Z-Asn-apns-pro-NH-t-but |
| Cbz-Asn-Apns-Pro-NH-tBu |
| Kni-102 |
| Z-Asp(OBzl)-ONp |
| Z-L-Asp(Bzl)-ONP |
